C37H43NO12 — CID 75593343
propan-2-yl 2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carboxylate (PubChem CID 75593343) has the molecular formula C37H43NO12 and a molecular weight of 693.75 g/mol. Its IUPAC name is propan-2-yl 2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carboxylate.
| Compound Name | propan-2-yl 2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 75593343 |
| Molecular Formula | C37H43NO12 |
| Molecular Weight | 693.75 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | propan-2-yl 2,7-bis[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]ethynyl]spiro[fluorene-9,4'-piperidine]-1'-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC2(CC1)c1cc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)ccc1-c1ccc(C#C[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]3O)cc12 |
| InChI | InChI=1S/C37H43NO12/c1-19(2)48-36(47)38-13-11-37(12-14-38)24-15-20(5-9-26-30(41)34(45)32(43)28(17-39)49-26)3-7-22(24)23-8-4-21(16-25(23)37)6-10-27-31(42)35(46)33(44)29(18-40)50-27/h3-4,7-8,15-16,19,26-35,39-46H,11-14,17-18H2,1-2H3/t26-,27-,28-,29-,30-,31-,32-,33-,34-,35-/m1/s1 |
| InChIKey | GUXGEUODIOHPJH-XFQBFFPDSA-N |
| XLogP | -1.02 |
| TPSA | 209.84 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.75 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|