About 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide
1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide (PubChem CID 75593386) has the molecular formula C10H18N5O5P
and a molecular weight of 319.26 g/mol. Its IUPAC name is 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide.
Molecular Properties
| Compound Name | 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide |
| PubChem CID | 75593386 |
| Molecular Formula | C10H18N5O5P |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide |
| SMILES | CCOP(=O)(CCn1nnc(C(N)=O)c1C(N)=O)OCC |
| InChI | InChI=1S/C10H18N5O5P/c1-3-19-21(18,20-4-2)6-5-15-8(10(12)17)7(9(11)16)13-14-15/h3-6H2,1-2H3,(H2,11,16)(H2,12,17) |
| InChIKey | PSTLPSBPFGZTNE-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide?
The IUPAC name of 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide (CID 75593386) is 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide.
What is the SMILES notation for 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide?
The canonical SMILES for 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide is CCOP(=O)(CCn1nnc(C(N)=O)c1C(N)=O)OCC.
What is the InChIKey of 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide?
The InChIKey is PSTLPSBPFGZTNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N5O5P/c1-3-19-21(18,20-4-2)6-5-15-8(10(12)17)7(9(11)16)13-14-15/h3-6H2,1-2H3,(H2,11,16)(H2,12,17).
What are the key properties of 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide?
1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide has a molecular weight of 319.26 g/mol, XLogP of -0.26, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-diethoxyphosphorylethyl)triazole-4,5-dicarboxamide is sourced from PubChem (CID 75593386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).