C26H33NO5 — CID 75597846
[6-acetyloxy-7-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-1,3-benzoxazol-5-yl] acetate (PubChem CID 75597846) has the molecular formula C26H33NO5 and a molecular weight of 439.55 g/mol. Its IUPAC name is [6-acetyloxy-7-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-1,3-benzoxazol-5-yl] acetate.
| Compound Name | [6-acetyloxy-7-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-1,3-benzoxazol-5-yl] acetate |
|---|---|
| PubChem CID | 75597846 |
| Molecular Formula | C26H33NO5 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | [6-acetyloxy-7-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]-1,3-benzoxazol-5-yl] acetate |
| SMILES | C=C1CCCC2C1(C)CCC(C)C2(C)Cc1c(OC(C)=O)c(OC(C)=O)cc2ncoc12 |
| InChI | InChI=1S/C26H33NO5/c1-15-8-7-9-22-25(15,5)11-10-16(2)26(22,6)13-19-23-20(27-14-30-23)12-21(31-17(3)28)24(19)32-18(4)29/h12,14,16,22H,1,7-11,13H2,2-6H3 |
| InChIKey | LBTUMRYFDFRELU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|