C21H20N6O3 — CID 75600493
N-[2-(methylamino)-2-oxo-1-phenylethyl]-9-(4-oxidopyrazin-4-ium-2-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide (PubChem CID 75600493) has the molecular formula C21H20N6O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[2-(methylamino)-2-oxo-1-phenylethyl]-9-(4-oxidopyrazin-4-ium-2-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide.
| Compound Name | N-[2-(methylamino)-2-oxo-1-phenylethyl]-9-(4-oxidopyrazin-4-ium-2-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
|---|---|
| PubChem CID | 75600493 |
| Molecular Formula | C21H20N6O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | N-[2-(methylamino)-2-oxo-1-phenylethyl]-9-(4-oxidopyrazin-4-ium-2-yl)-8,9-diazatricyclo[4.3.0.02,4]nona-1(6),7-diene-7-carboxamide |
| SMILES | CNC(=O)C(NC(=O)c1nn(-c2c[n+]([O-])ccn2)c2c1CC1CC21)c1ccccc1 |
| InChI | InChI=1S/C21H20N6O3/c1-22-20(28)17(12-5-3-2-4-6-12)24-21(29)18-15-10-13-9-14(13)19(15)27(25-18)16-11-26(30)8-7-23-16/h2-8,11,13-14,17H,9-10H2,1H3,(H,22,28)(H,24,29) |
| InChIKey | SPIKZZOCMBRDFN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 115.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|