C35H56O9 — CID 75601318
16-(3,9-dihydroxy-4,8,10-trimethyl-5-oxoundec-6-en-2-yl)-8-hydroxy-11-(hydroxymethyl)-3,15-dimethoxy-5,7,9-trimethyl-1-oxacyclohexadeca-3,5,11,13-tetraen-2-one (PubChem CID 75601318) has the molecular formula C35H56O9 and a molecular weight of 620.82 g/mol. Its IUPAC name is 16-(3,9-dihydroxy-4,8,10-trimethyl-5-oxoundec-6-en-2-yl)-8-hydroxy-11-(hydroxymethyl)-3,15-dimethoxy-5,7,9-trimethyl-1-oxacyclohexadeca-3,5,11,13-tetraen-2-one.
| Compound Name | 16-(3,9-dihydroxy-4,8,10-trimethyl-5-oxoundec-6-en-2-yl)-8-hydroxy-11-(hydroxymethyl)-3,15-dimethoxy-5,7,9-trimethyl-1-oxacyclohexadeca-3,5,11,13-tetraen-2-one |
|---|---|
| PubChem CID | 75601318 |
| Molecular Formula | C35H56O9 |
| Molecular Weight | 620.82 g/mol |
| Exact Mass | 620.39 |
| IUPAC Name | 16-(3,9-dihydroxy-4,8,10-trimethyl-5-oxoundec-6-en-2-yl)-8-hydroxy-11-(hydroxymethyl)-3,15-dimethoxy-5,7,9-trimethyl-1-oxacyclohexadeca-3,5,11,13-tetraen-2-one |
| SMILES | COC1=CC(C)=CC(C)C(O)C(C)CC(CO)=CC=CC(OC)C(C(C)C(O)C(C)C(=O)C=CC(C)C(O)C(C)C)OC1=O |
| InChI | InChI=1S/C35H56O9/c1-20(2)31(38)22(4)14-15-28(37)25(7)33(40)26(8)34-29(42-9)13-11-12-27(19-36)18-24(6)32(39)23(5)16-21(3)17-30(43-10)35(41)44-34/h11-17,20,22-26,29,31-34,36,38-40H,18-19H2,1-10H3 |
| InChIKey | FFGYDUDLLJGAOQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|