C11H15FN6O3 — CID 75604203
5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 75604203) has the molecular formula C11H15FN6O3 and a molecular weight of 298.28 g/mol. Its IUPAC name is 5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | 5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 75604203 |
| Molecular Formula | C11H15FN6O3 |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-(2,4-diaminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | CC1(F)C(c2cnc3c(N)nc(N)nn23)OC(CO)C1O |
| InChI | InChI=1S/C11H15FN6O3/c1-11(12)6(20)5(3-19)21-7(11)4-2-15-9-8(13)16-10(14)17-18(4)9/h2,5-7,19-20H,3H2,1H3,(H4,13,14,16,17) |
| InChIKey | IXQFPUODRPFKLR-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|