About 1-piperidin-3-yl-1,3-diazinane-2,4-dione
1-piperidin-3-yl-1,3-diazinane-2,4-dione (PubChem CID 75607085) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-piperidin-3-yl-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | 1-piperidin-3-yl-1,3-diazinane-2,4-dione |
| PubChem CID | 75607085 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-piperidin-3-yl-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(C2CCCNC2)C(=O)N1 |
| InChI | InChI=1S/C9H15N3O2/c13-8-3-5-12(9(14)11-8)7-2-1-4-10-6-7/h7,10H,1-6H2,(H,11,13,14) |
| InChIKey | BGHULKIYDGQRLL-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-piperidin-3-yl-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-piperidin-3-yl-1,3-diazinane-2,4-dione?
The IUPAC name of 1-piperidin-3-yl-1,3-diazinane-2,4-dione (CID 75607085) is 1-piperidin-3-yl-1,3-diazinane-2,4-dione.
What is the SMILES notation for 1-piperidin-3-yl-1,3-diazinane-2,4-dione?
The canonical SMILES for 1-piperidin-3-yl-1,3-diazinane-2,4-dione is O=C1CCN(C2CCCNC2)C(=O)N1.
What is the InChIKey of 1-piperidin-3-yl-1,3-diazinane-2,4-dione?
The InChIKey is BGHULKIYDGQRLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c13-8-3-5-12(9(14)11-8)7-2-1-4-10-6-7/h7,10H,1-6H2,(H,11,13,14).
What are the key properties of 1-piperidin-3-yl-1,3-diazinane-2,4-dione?
1-piperidin-3-yl-1,3-diazinane-2,4-dione has a molecular weight of 197.24 g/mol, XLogP of -0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-piperidin-3-yl-1,3-diazinane-2,4-dione is sourced from PubChem (CID 75607085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).