C22H11F3N2O3S — CID 75607234
4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxy-2-(trifluoromethyl)benzonitrile (PubChem CID 75607234) has the molecular formula C22H11F3N2O3S and a molecular weight of 440.40 g/mol. Its IUPAC name is 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxy-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxy-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 75607234 |
| Molecular Formula | C22H11F3N2O3S |
| Molecular Weight | 440.40 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 4-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]naphthalen-1-yl]oxy-2-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(C=C3SC(=O)NC3=O)c3ccccc23)cc1C(F)(F)F |
| InChI | InChI=1S/C22H11F3N2O3S/c23-22(24,25)17-10-14(7-5-13(17)11-26)30-18-8-6-12(15-3-1-2-4-16(15)18)9-19-20(28)27-21(29)31-19/h1-10H,(H,27,28,29) |
| InChIKey | CIRQREHSLLSRKH-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|