C9H15N4O3+ — CID 75608239
(1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)-propylazanium (PubChem CID 75608239) has the molecular formula C9H15N4O3+ and a molecular weight of 227.24 g/mol. Its IUPAC name is (1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)-propylazanium.
| Compound Name | (1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)-propylazanium |
|---|---|
| PubChem CID | 75608239 |
| Molecular Formula | C9H15N4O3+ |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | (1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)-propylazanium |
| SMILES | CCC/[NH+]=C1\C(N=O)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C9H14N4O3/c1-4-5-10-7-6(11-16)8(14)13(3)9(15)12(7)2/h6H,4-5H2,1-3H3/p+1/b10-7+ |
| InChIKey | CTKDMVOGIZAZEG-JXMROGBWSA-O |
| XLogP | -1.47 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|