C11H19N4O3+ — CID 75608241
(1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)-pentylazanium (PubChem CID 75608241) has the molecular formula C11H19N4O3+ and a molecular weight of 255.30 g/mol. Its IUPAC name is (1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)-pentylazanium.
| Compound Name | (1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)-pentylazanium |
|---|---|
| PubChem CID | 75608241 |
| Molecular Formula | C11H19N4O3+ |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (1,3-dimethyl-5-nitroso-2,6-dioxo-1,3-diazinan-4-ylidene)-pentylazanium |
| SMILES | CCCCC/[NH+]=C1\C(N=O)C(=O)N(C)C(=O)N1C |
| InChI | InChI=1S/C11H18N4O3/c1-4-5-6-7-12-9-8(13-18)10(16)15(3)11(17)14(9)2/h8H,4-7H2,1-3H3/p+1/b12-9+ |
| InChIKey | TXHMNQQXMLGSSH-FMIVXFBMSA-O |
| XLogP | -0.69 |
| TPSA | 84.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|