C15H14N2O3S2 — CID 75608323
1-thiophen-2-yl-N-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)methanimine (PubChem CID 75608323) has the molecular formula C15H14N2O3S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-thiophen-2-yl-N-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)methanimine.
| Compound Name | 1-thiophen-2-yl-N-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)methanimine |
|---|---|
| PubChem CID | 75608323 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-thiophen-2-yl-N-(5,6,7-trimethoxy-1,3-benzothiazol-2-yl)methanimine |
| SMILES | COc1cc2nc(N=Cc3cccs3)sc2c(OC)c1OC |
| InChI | InChI=1S/C15H14N2O3S2/c1-18-11-7-10-14(13(20-3)12(11)19-2)22-15(17-10)16-8-9-5-4-6-21-9/h4-8H,1-3H3 |
| InChIKey | GRYZKUSYASYDEX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 52.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|