About 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile
3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile (PubChem CID 75608940) has the molecular formula C12H13N6O2S+
and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile.
Molecular Properties
| Compound Name | 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile |
| PubChem CID | 75608940 |
| Molecular Formula | C12H13N6O2S+ |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile |
| SMILES | CN1C(=O)C2C(=NC(SCCC#N)=[N+]2CC#N)N(C)C1=O |
| InChI | InChI=1S/C12H13N6O2S/c1-16-9-8(10(19)17(2)12(16)20)18(6-5-14)11(15-9)21-7-3-4-13/h8H,3,6-7H2,1-2H3/q+1 |
| InChIKey | XAKXUGKAQPXPKJ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 103.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile?
The IUPAC name of 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile (CID 75608940) is 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile.
What is the SMILES notation for 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile?
The canonical SMILES for 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile is CN1C(=O)C2C(=NC(SCCC#N)=[N+]2CC#N)N(C)C1=O.
What is the InChIKey of 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile?
The InChIKey is XAKXUGKAQPXPKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N6O2S/c1-16-9-8(10(19)17(2)12(16)20)18(6-5-14)11(15-9)21-7-3-4-13/h8H,3,6-7H2,1-2H3/q+1.
What are the key properties of 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile?
3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile has a molecular weight of 305.34 g/mol, XLogP of -0.17, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[7-(cyanomethyl)-1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-8-yl]sulfanyl]propanenitrile is sourced from PubChem (CID 75608940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).