About 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile
2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile (PubChem CID 75608941) has the molecular formula C12H14N5O3S+
and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile |
| PubChem CID | 75608941 |
| Molecular Formula | C12H14N5O3S+ |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile |
| SMILES | CC(=O)CSC1=[N+](CC#N)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C12H14N5O3S/c1-7(18)6-21-11-14-9-8(17(11)5-4-13)10(19)16(3)12(20)15(9)2/h8H,5-6H2,1-3H3/q+1 |
| InChIKey | GSLPLVGPAIADNJ-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 96.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile?
The IUPAC name of 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile (CID 75608941) is 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile.
What is the SMILES notation for 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile?
The canonical SMILES for 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile is CC(=O)CSC1=[N+](CC#N)C2C(=O)N(C)C(=O)N(C)C2=N1.
What is the InChIKey of 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile?
The InChIKey is GSLPLVGPAIADNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N5O3S/c1-7(18)6-21-11-14-9-8(17(11)5-4-13)10(19)16(3)12(20)15(9)2/h8H,5-6H2,1-3H3/q+1.
What are the key properties of 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile?
2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile has a molecular weight of 308.34 g/mol, XLogP of -0.49, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-dimethyl-2,6-dioxo-8-(2-oxopropylsulfanyl)-5H-purin-7-ium-7-yl]acetonitrile is sourced from PubChem (CID 75608941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).