C13H19N6O2S+ — CID 75608998
1,3,7-trimethyl-8-(1,4,5,6-tetrahydropyrimidin-2-ylmethylsulfanyl)-5H-purin-7-ium-2,6-dione (PubChem CID 75608998) has the molecular formula C13H19N6O2S+ and a molecular weight of 323.40 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-(1,4,5,6-tetrahydropyrimidin-2-ylmethylsulfanyl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-(1,4,5,6-tetrahydropyrimidin-2-ylmethylsulfanyl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 75608998 |
| Molecular Formula | C13H19N6O2S+ |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1,3,7-trimethyl-8-(1,4,5,6-tetrahydropyrimidin-2-ylmethylsulfanyl)-5H-purin-7-ium-2,6-dione |
| SMILES | CN1C(=O)C2C(=NC(SCC3=NCCCN3)=[N+]2C)N(C)C1=O |
| InChI | InChI=1S/C13H19N6O2S/c1-17-9-10(18(2)13(21)19(3)11(9)20)16-12(17)22-7-8-14-5-4-6-15-8/h9H,4-7H2,1-3H3,(H,14,15)/q+1 |
| InChIKey | ITKFWSMQOYNWNW-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|