About 4-Bromophenyl isocyanate
4-Bromophenyl isocyanate (PubChem CID 75609) has the molecular formula C7H4BrNO
and a molecular weight of 198.02 g/mol. Its IUPAC name is 1-bromo-4-isocyanatobenzene.
Molecular Properties
| Compound Name | 4-Bromophenyl isocyanate |
| PubChem CID | 75609 |
| Molecular Formula | C7H4BrNO |
| Molecular Weight | 198.02 g/mol |
| Exact Mass | 196.95 |
| IUPAC Name | 1-bromo-4-isocyanatobenzene |
| SMILES | C1=CC(=CC=C1N=C=O)Br |
| InChI | InChI=1S/C7H4BrNO/c8-6-1-3-7(4-2-6)9-5-10/h1-4H |
| InChIKey | CZQIJQFTRGDODI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | 146 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.02 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 4-Bromophenyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-Bromophenyl isocyanate?
The IUPAC name of 4-Bromophenyl isocyanate (CID 75609) is 1-bromo-4-isocyanatobenzene.
What is the SMILES notation for 4-Bromophenyl isocyanate?
The canonical SMILES for 4-Bromophenyl isocyanate is C1=CC(=CC=C1N=C=O)Br.
What is the InChIKey of 4-Bromophenyl isocyanate?
The InChIKey is CZQIJQFTRGDODI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrNO/c8-6-1-3-7(4-2-6)9-5-10/h1-4H.
What are the key properties of 4-Bromophenyl isocyanate?
4-Bromophenyl isocyanate has a molecular weight of 198.02 g/mol, XLogP of 3.40, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-Bromophenyl isocyanate is sourced from PubChem (CID 75609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).