C19H28FN5O — CID 75614255
2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazol-5-yl-[4-[(2-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone (PubChem CID 75614255) has the molecular formula C19H28FN5O and a molecular weight of 361.47 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazol-5-yl-[4-[(2-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazol-5-yl-[4-[(2-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 75614255 |
| Molecular Formula | C19H28FN5O |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-benzotriazol-5-yl-[4-[(2-fluorophenyl)methyl]-1,4-diazepan-1-yl]methanone |
| SMILES | O=C(C1CCC2NNNC2C1)N1CCCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C19H28FN5O/c20-16-5-2-1-4-15(16)13-24-8-3-9-25(11-10-24)19(26)14-6-7-17-18(12-14)22-23-21-17/h1-2,4-5,14,17-18,21-23H,3,6-13H2 |
| InChIKey | CWTWWMIXYZLAHR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |