C20H23N5O — CID 75615327
N,N-dimethyl-4-[[3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]aniline (PubChem CID 75615327) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is N,N-dimethyl-4-[[3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]aniline.
| Compound Name | N,N-dimethyl-4-[[3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 75615327 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | N,N-dimethyl-4-[[3-(5-pyridin-3-yl-1,3,4-oxadiazol-2-yl)pyrrolidin-1-yl]methyl]aniline |
| SMILES | CN(C)c1ccc(CN2CCC(c3nnc(-c4cccnc4)o3)C2)cc1 |
| InChI | InChI=1S/C20H23N5O/c1-24(2)18-7-5-15(6-8-18)13-25-11-9-17(14-25)20-23-22-19(26-20)16-4-3-10-21-12-16/h3-8,10,12,17H,9,11,13-14H2,1-2H3 |
| InChIKey | CONKXKQXXMOCII-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|