C26H38N4O2 — CID 75616122
[4-(2-methoxyethyl)piperazin-1-yl]-[9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-11-yl]methanone (PubChem CID 75616122) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is [4-(2-methoxyethyl)piperazin-1-yl]-[9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-11-yl]methanone.
| Compound Name | [4-(2-methoxyethyl)piperazin-1-yl]-[9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-11-yl]methanone |
|---|---|
| PubChem CID | 75616122 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | [4-(2-methoxyethyl)piperazin-1-yl]-[9-(2-methylpropyl)-3-prop-2-enyl-3,10-diazatricyclo[6.4.1.04,13]trideca-1,4,6,8(13)-tetraen-11-yl]methanone |
| SMILES | C=CCn1cc2c3c(cccc31)C(CC(C)C)NC(C(=O)N1CCN(CCOC)CC1)C2 |
| InChI | InChI=1S/C26H38N4O2/c1-5-9-30-18-20-17-23(26(31)29-12-10-28(11-13-29)14-15-32-4)27-22(16-19(2)3)21-7-6-8-24(30)25(20)21/h5-8,18-19,22-23,27H,1,9-17H2,2-4H3 |
| InChIKey | UVDIBTKJUCOEFZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|