C19H19FN4O2S — CID 7561633
1-(5-fluoro-2-methoxyphenyl)-2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 7561633) has the molecular formula C19H19FN4O2S and a molecular weight of 386.45 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)-2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)-2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 7561633 |
| Molecular Formula | C19H19FN4O2S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)-2-[1-(4-propan-2-ylphenyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | COc1ccc(F)cc1C(=O)CSc1nnnn1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C19H19FN4O2S/c1-12(2)13-4-7-15(8-5-13)24-19(21-22-23-24)27-11-17(25)16-10-14(20)6-9-18(16)26-3/h4-10,12H,11H2,1-3H3 |
| InChIKey | AOGRYVOUTVJSKJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |