C16H24N5O3+ — CID 75616421
N-cyclohexyl-2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N-methylacetamide (PubChem CID 75616421) has the molecular formula C16H24N5O3+ and a molecular weight of 334.40 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N-methylacetamide.
| Compound Name | N-cyclohexyl-2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 75616421 |
| Molecular Formula | C16H24N5O3+ |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | N-cyclohexyl-2-(3,7-dimethyl-2,6-dioxo-5H-purin-7-ium-1-yl)-N-methylacetamide |
| SMILES | CN1C(=O)N(CC(=O)N(C)C2CCCCC2)C(=O)C2C1=NC=[N+]2C |
| InChI | InChI=1S/C16H24N5O3/c1-18-10-17-14-13(18)15(23)21(16(24)20(14)3)9-12(22)19(2)11-7-5-4-6-8-11/h10-11,13H,4-9H2,1-3H3/q+1 |
| InChIKey | KWFSMGYFHQGPBV-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|