About [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate (PubChem CID 7562156) has the molecular formula C18H18ClNO4S
and a molecular weight of 379.87 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate.
Molecular Properties
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate |
| PubChem CID | 7562156 |
| Molecular Formula | C18H18ClNO4S |
| Molecular Weight | 379.87 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate |
| SMILES | CCS(=O)c1ccccc1C(=O)OCC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO4S/c1-2-25(23)16-6-4-3-5-15(16)18(22)24-12-17(21)20-11-13-7-9-14(19)10-8-13/h3-10H,2,11-12H2,1H3,(H,20,21) |
| InChIKey | FDHWHELPSBIYPF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.87 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate?
The IUPAC name of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate (CID 7562156) is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate.
What is the SMILES notation for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate?
The canonical SMILES for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate is CCS(=O)c1ccccc1C(=O)OCC(=O)NCc1ccc(Cl)cc1.
What is the InChIKey of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate?
The InChIKey is FDHWHELPSBIYPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18ClNO4S/c1-2-25(23)16-6-4-3-5-15(16)18(22)24-12-17(21)20-11-13-7-9-14(19)10-8-13/h3-10H,2,11-12H2,1H3,(H,20,21).
What are the key properties of [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate?
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate has a molecular weight of 379.87 g/mol, XLogP of 2.94, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-ethylsulfinylbenzoate is sourced from PubChem (CID 7562156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).