C24H21NO8S — CID 75627337
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3-sulfophenyl)propanoic acid (PubChem CID 75627337) has the molecular formula C24H21NO8S and a molecular weight of 483.50 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3-sulfophenyl)propanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3-sulfophenyl)propanoic acid |
|---|---|
| PubChem CID | 75627337 |
| Molecular Formula | C24H21NO8S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxy-3-sulfophenyl)propanoic acid |
| SMILES | O=C(NC(Cc1ccc(O)c(S(=O)(=O)O)c1)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H21NO8S/c26-21-10-9-14(12-22(21)34(30,31)32)11-20(23(27)28)25-24(29)33-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-10,12,19-20,26H,11,13H2,(H,25,29)(H,27,28)(H,30,31,32) |
| InChIKey | VFMYSOFCARCHKY-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|