About 1,4-bis(sulfanyl)butane-2,3-diol
1,4-bis(sulfanyl)butane-2,3-diol (PubChem CID 75627643) has the molecular formula C8H20O4S4
and a molecular weight of 308.51 g/mol. Its IUPAC name is 1,4-bis(sulfanyl)butane-2,3-diol.
Molecular Properties
| Compound Name | 1,4-bis(sulfanyl)butane-2,3-diol |
| PubChem CID | 75627643 |
| Molecular Formula | C8H20O4S4 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 1,4-bis(sulfanyl)butane-2,3-diol |
| SMILES | OC(CS)C(O)CS.OC(CS)C(O)CS |
| InChI | InChI=1S/2C4H10O2S2/c2*5-3(1-7)4(6)2-8/h2*3-8H,1-2H2 |
| InChIKey | DCRJBUYBNCQKEE-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(sulfanyl)butane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(sulfanyl)butane-2,3-diol?
The IUPAC name of 1,4-bis(sulfanyl)butane-2,3-diol (CID 75627643) is 1,4-bis(sulfanyl)butane-2,3-diol.
What is the SMILES notation for 1,4-bis(sulfanyl)butane-2,3-diol?
The canonical SMILES for 1,4-bis(sulfanyl)butane-2,3-diol is OC(CS)C(O)CS.OC(CS)C(O)CS.
What is the InChIKey of 1,4-bis(sulfanyl)butane-2,3-diol?
The InChIKey is DCRJBUYBNCQKEE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H10O2S2/c2*5-3(1-7)4(6)2-8/h2*3-8H,1-2H2.
What are the key properties of 1,4-bis(sulfanyl)butane-2,3-diol?
1,4-bis(sulfanyl)butane-2,3-diol has a molecular weight of 308.51 g/mol, XLogP of -0.86, 6 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(sulfanyl)butane-2,3-diol is sourced from PubChem (CID 75627643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).