C19H20FN5OS — CID 7563038
2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-N-[(1S)-1-phenylbutyl]acetamide (PubChem CID 7563038) has the molecular formula C19H20FN5OS and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-N-[(1S)-1-phenylbutyl]acetamide.
| Compound Name | 2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-N-[(1S)-1-phenylbutyl]acetamide |
|---|---|
| PubChem CID | 7563038 |
| Molecular Formula | C19H20FN5OS |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[1-(3-fluorophenyl)tetrazol-5-yl]sulfanyl-N-[(1S)-1-phenylbutyl]acetamide |
| SMILES | CCC[C@H](NC(=O)CSc1nnnn1-c1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H20FN5OS/c1-2-7-17(14-8-4-3-5-9-14)21-18(26)13-27-19-22-23-24-25(19)16-11-6-10-15(20)12-16/h3-6,8-12,17H,2,7,13H2,1H3,(H,21,26)/t17-/m0/s1 |
| InChIKey | NFVJONXNWBITDP-KRWDZBQOSA-N |
| XLogP | 3.55 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |