C21H21ClN4 — CID 75631217
7-chloro-10-(2-pyrimidin-4-ylprop-1-enyl)-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indole (PubChem CID 75631217) has the molecular formula C21H21ClN4 and a molecular weight of 364.88 g/mol. Its IUPAC name is 7-chloro-10-(2-pyrimidin-4-ylprop-1-enyl)-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indole.
| Compound Name | 7-chloro-10-(2-pyrimidin-4-ylprop-1-enyl)-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indole |
|---|---|
| PubChem CID | 75631217 |
| Molecular Formula | C21H21ClN4 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 7-chloro-10-(2-pyrimidin-4-ylprop-1-enyl)-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indole |
| SMILES | CC(=Cn1c2c(c3cc(Cl)ccc31)CN1CCCC1C2)c1ccncn1 |
| InChI | InChI=1S/C21H21ClN4/c1-14(19-6-7-23-13-24-19)11-26-20-5-4-15(22)9-17(20)18-12-25-8-2-3-16(25)10-21(18)26/h4-7,9,11,13,16H,2-3,8,10,12H2,1H3 |
| InChIKey | WAACFXSWVFMXLQ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |