C10H19F2NO2 — CID 75631375
1-butyl-5-(difluoromethyl)piperidine-3,4-diol (PubChem CID 75631375) has the molecular formula C10H19F2NO2 and a molecular weight of 223.26 g/mol. Its IUPAC name is 1-butyl-5-(difluoromethyl)piperidine-3,4-diol.
| Compound Name | 1-butyl-5-(difluoromethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 75631375 |
| Molecular Formula | C10H19F2NO2 |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-butyl-5-(difluoromethyl)piperidine-3,4-diol |
| SMILES | CCCCN1CC(O)C(O)C(C(F)F)C1 |
| InChI | InChI=1S/C10H19F2NO2/c1-2-3-4-13-5-7(10(11)12)9(15)8(14)6-13/h7-10,14-15H,2-6H2,1H3 |
| InChIKey | VKDRELSVZAHLFA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |