(Z)-dec-5-enedioic acid

C10H16O4 — CID 7563148

IUPAC(Z)-dec-5-enedioic acid
SMILESO=C(O)CCC/C=C\CCCC(=O)O
InChIInChI=1S/C10H16O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-2H,3-8H2,(H,11,12)(H,13,14)/b2-1-
InChIKeyWAGQZQAZCIOEDU-UPHRSURJSA-N
MW200.23 g/mol
LogP2.05
Rot. Bonds8

About (Z)-dec-5-enedioic acid

(Z)-dec-5-enedioic acid (PubChem CID 7563148) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (Z)-dec-5-enedioic acid.

Molecular Properties

Compound Name(Z)-dec-5-enedioic acid
PubChem CID7563148
Molecular FormulaC10H16O4
Molecular Weight200.23 g/mol
Exact Mass200.10
IUPAC Name(Z)-dec-5-enedioic acid
SMILESO=C(O)CCC/C=C\CCCC(=O)O
InChIInChI=1S/C10H16O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-2H,3-8H2,(H,11,12)(H,13,14)/b2-1-
InChIKeyWAGQZQAZCIOEDU-UPHRSURJSA-N
XLogP2.05
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500200.23
LogP ≤ 52.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-dec-5-enedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-dec-5-enedioic acid?
The IUPAC name of (Z)-dec-5-enedioic acid (CID 7563148) is (Z)-dec-5-enedioic acid.
What is the SMILES notation for (Z)-dec-5-enedioic acid?
The canonical SMILES for (Z)-dec-5-enedioic acid is O=C(O)CCC/C=C\CCCC(=O)O.
What is the InChIKey of (Z)-dec-5-enedioic acid?
The InChIKey is WAGQZQAZCIOEDU-UPHRSURJSA-N. The full InChI is InChI=1S/C10H16O4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14/h1-2H,3-8H2,(H,11,12)(H,13,14)/b2-1-.
What are the key properties of (Z)-dec-5-enedioic acid?
(Z)-dec-5-enedioic acid has a molecular weight of 200.23 g/mol, XLogP of 2.05, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-dec-5-enedioic acid is sourced from PubChem (CID 7563148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).