About 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide
3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide (PubChem CID 75632447) has the molecular formula C9H18N2O2S2
and a molecular weight of 250.39 g/mol. Its IUPAC name is 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide |
| PubChem CID | 75632447 |
| Molecular Formula | C9H18N2O2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide |
| SMILES | O=S1(=O)CCSCC(CN2CCCC2)N1 |
| InChI | InChI=1S/C9H18N2O2S2/c12-15(13)6-5-14-8-9(10-15)7-11-3-1-2-4-11/h9-10H,1-8H2 |
| InChIKey | SEJWMTUKPFDNLZ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide?
The IUPAC name of 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide (CID 75632447) is 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide.
What is the SMILES notation for 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide?
The canonical SMILES for 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide is O=S1(=O)CCSCC(CN2CCCC2)N1.
What is the InChIKey of 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide?
The InChIKey is SEJWMTUKPFDNLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2S2/c12-15(13)6-5-14-8-9(10-15)7-11-3-1-2-4-11/h9-10H,1-8H2.
What are the key properties of 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide?
3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide has a molecular weight of 250.39 g/mol, XLogP of 0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(pyrrolidin-1-ylmethyl)-1,5,2-dithiazepane 1,1-dioxide is sourced from PubChem (CID 75632447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).