C10H16N2O4S2 — CID 75632454
1,1-dioxo-8-propan-2-yl-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione (PubChem CID 75632454) has the molecular formula C10H16N2O4S2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1,1-dioxo-8-propan-2-yl-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione.
| Compound Name | 1,1-dioxo-8-propan-2-yl-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione |
|---|---|
| PubChem CID | 75632454 |
| Molecular Formula | C10H16N2O4S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1,1-dioxo-8-propan-2-yl-2,3,5,5a,7,8-hexahydropyrazino[1,2-b][1,5,2]dithiazepine-6,9-dione |
| SMILES | CC(C)C1NC(=O)C2CSCCS(=O)(=O)N2C1=O |
| InChI | InChI=1S/C10H16N2O4S2/c1-6(2)8-10(14)12-7(9(13)11-8)5-17-3-4-18(12,15)16/h6-8H,3-5H2,1-2H3,(H,11,13) |
| InChIKey | PRAABKKIHHPSSV-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |