C19H18N4O2 — CID 75644965
6-amino-4-(4-hydroxyphenyl)-3-phenyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 75644965) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 6-amino-4-(4-hydroxyphenyl)-3-phenyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-amino-4-(4-hydroxyphenyl)-3-phenyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 75644965 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 6-amino-4-(4-hydroxyphenyl)-3-phenyl-1,2,3,3a,4,7a-hexahydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | N#CC1=C(N)OC2NNC(c3ccccc3)C2C1c1ccc(O)cc1 |
| InChI | InChI=1S/C19H18N4O2/c20-10-14-15(11-6-8-13(24)9-7-11)16-17(12-4-2-1-3-5-12)22-23-19(16)25-18(14)21/h1-9,15-17,19,22-24H,21H2 |
| InChIKey | YZMRFQSHMDLZOF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |