About 1-bromo-4-phenoxybenzene
1-bromo-4-phenoxybenzene (PubChem CID 7565) has the molecular formula C12H9BrO
and a molecular weight of 249.11 g/mol. Its IUPAC name is 1-bromo-4-phenoxybenzene.
Molecular Properties
| Compound Name | 1-bromo-4-phenoxybenzene |
| PubChem CID | 7565 |
| Molecular Formula | C12H9BrO |
| Molecular Weight | 249.11 g/mol |
| Exact Mass | 247.98 |
| IUPAC Name | 1-bromo-4-phenoxybenzene |
| SMILES | Brc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H9BrO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H |
| InChIKey | JDUYPUMQALQRCN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.11 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-phenoxybenzene?
The IUPAC name of 1-bromo-4-phenoxybenzene (CID 7565) is 1-bromo-4-phenoxybenzene.
What is the SMILES notation for 1-bromo-4-phenoxybenzene?
The canonical SMILES for 1-bromo-4-phenoxybenzene is Brc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 1-bromo-4-phenoxybenzene?
The InChIKey is JDUYPUMQALQRCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9BrO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H.
What are the key properties of 1-bromo-4-phenoxybenzene?
1-bromo-4-phenoxybenzene has a molecular weight of 249.11 g/mol, XLogP of 4.24, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-phenoxybenzene is sourced from PubChem (CID 7565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).