C18H23N3O4S — CID 75650622
diethyl 2-[[4-[(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)amino]phenyl]iminomethyl]propanedioate (PubChem CID 75650622) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is diethyl 2-[[4-[(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)amino]phenyl]iminomethyl]propanedioate.
| Compound Name | diethyl 2-[[4-[(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)amino]phenyl]iminomethyl]propanedioate |
|---|---|
| PubChem CID | 75650622 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | diethyl 2-[[4-[(5-methyl-4,5-dihydro-1,3-thiazol-2-yl)amino]phenyl]iminomethyl]propanedioate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(NC2=NCC(C)S2)cc1)C(=O)OCC |
| InChI | InChI=1S/C18H23N3O4S/c1-4-24-16(22)15(17(23)25-5-2)11-19-13-6-8-14(9-7-13)21-18-20-10-12(3)26-18/h6-9,11-12,15H,4-5,10H2,1-3H3,(H,20,21)/b19-11+ |
| InChIKey | MKQXETKEWOIERT-YBFXNURJSA-N |
| XLogP | 3.03 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|