C24H28N2O3 — CID 75657754
4-[(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methyl]benzamide (PubChem CID 75657754) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methyl]benzamide.
| Compound Name | 4-[(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methyl]benzamide |
|---|---|
| PubChem CID | 75657754 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 4-[(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methyl]benzamide |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1Cc1ccc(C(N)=O)cc1)OCCO3 |
| InChI | InChI=1S/C24H28N2O3/c1-16-19-12-21-22(29-11-10-28-21)13-20(19)24(8-2-3-9-24)15-26(16)14-17-4-6-18(7-5-17)23(25)27/h4-7,12-13,16H,2-3,8-11,14-15H2,1H3,(H2,25,27) |
| InChIKey | JXCOTTILIFKJNU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |