About N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide
N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide (PubChem CID 756581) has the molecular formula C17H18N2O
and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide |
| PubChem CID | 756581 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide |
| SMILES | CC(=O)N(C)N1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C17H18N2O/c1-13(20)18(2)19-16-9-5-3-7-14(16)11-12-15-8-4-6-10-17(15)19/h3-10H,11-12H2,1-2H3 |
| InChIKey | CUOFQDKBXWQUKA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide?
The IUPAC name of N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide (CID 756581) is N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide.
What is the SMILES notation for N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide?
The canonical SMILES for N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide is CC(=O)N(C)N1c2ccccc2CCc2ccccc21.
What is the InChIKey of N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide?
The InChIKey is CUOFQDKBXWQUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O/c1-13(20)18(2)19-16-9-5-3-7-14(16)11-12-15-8-4-6-10-17(15)19/h3-10H,11-12H2,1-2H3.
What are the key properties of N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide?
N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide has a molecular weight of 266.34 g/mol, XLogP of 3.32, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-N-methylacetamide is sourced from PubChem (CID 756581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).