C23H27N3O4 — CID 7565866
(5S)-3-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]-5-[(2-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 7565866) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is (5S)-3-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]-5-[(2-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]-5-[(2-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7565866 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (5S)-3-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]-5-[(2-methoxyphenyl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | C=CCn1c(C)cc(C(=O)CN2C(=O)N[C@@](C)(Cc3ccccc3OC)C2=O)c1C |
| InChI | InChI=1S/C23H27N3O4/c1-6-11-25-15(2)12-18(16(25)3)19(27)14-26-21(28)23(4,24-22(26)29)13-17-9-7-8-10-20(17)30-5/h6-10,12H,1,11,13-14H2,2-5H3,(H,24,29)/t23-/m0/s1 |
| InChIKey | NKFQVTNPIMQWHC-QHCPKHFHSA-N |
| XLogP | 3.04 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|