C19H25Cl2N5O — CID 7566011
3-butyl-1-(2,4-dichlorophenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea (PubChem CID 7566011) has the molecular formula C19H25Cl2N5O and a molecular weight of 410.35 g/mol. Its IUPAC name is 3-butyl-1-(2,4-dichlorophenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea.
| Compound Name | 3-butyl-1-(2,4-dichlorophenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 7566011 |
| Molecular Formula | C19H25Cl2N5O |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 3-butyl-1-(2,4-dichlorophenyl)-1-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)urea |
| SMILES | CCCCNC(=O)N(Cc1nnc2n1CCCCC2)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H25Cl2N5O/c1-2-3-10-22-19(27)26(16-9-8-14(20)12-15(16)21)13-18-24-23-17-7-5-4-6-11-25(17)18/h8-9,12H,2-7,10-11,13H2,1H3,(H,22,27) |
| InChIKey | IXBVXILOANKDMP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|