C21H22N2O5 — CID 7566172
methyl 4-[[(4S)-4-[(2-methoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzoate (PubChem CID 7566172) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is methyl 4-[[(4S)-4-[(2-methoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[(4S)-4-[(2-methoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 7566172 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | methyl 4-[[(4S)-4-[(2-methoxyphenyl)methyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)N[C@@](C)(Cc3ccccc3OC)C2=O)cc1 |
| InChI | InChI=1S/C21H22N2O5/c1-21(12-16-6-4-5-7-17(16)27-2)19(25)23(20(26)22-21)13-14-8-10-15(11-9-14)18(24)28-3/h4-11H,12-13H2,1-3H3,(H,22,26)/t21-/m0/s1 |
| InChIKey | BDQTXXBFCUTYIS-NRFANRHFSA-N |
| XLogP | 2.54 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|