C18H28NO+ — CID 7567332
4-[(2S,6S)-2,6-bis(prop-2-enyl)-2,3-dihydro-1H-pyridin-1-ium-6-yl]hepta-1,6-dien-4-ol (PubChem CID 7567332) has the molecular formula C18H28NO+ and a molecular weight of 274.43 g/mol. Its IUPAC name is 4-[(2S,6S)-2,6-bis(prop-2-enyl)-2,3-dihydro-1H-pyridin-1-ium-6-yl]hepta-1,6-dien-4-ol.
| Compound Name | 4-[(2S,6S)-2,6-bis(prop-2-enyl)-2,3-dihydro-1H-pyridin-1-ium-6-yl]hepta-1,6-dien-4-ol |
|---|---|
| PubChem CID | 7567332 |
| Molecular Formula | C18H28NO+ |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 4-[(2S,6S)-2,6-bis(prop-2-enyl)-2,3-dihydro-1H-pyridin-1-ium-6-yl]hepta-1,6-dien-4-ol |
| SMILES | C=CC[C@H]1CC=C[C@@](CC=C)(C(O)(CC=C)CC=C)[NH2+]1 |
| InChI | InChI=1S/C18H27NO/c1-5-10-16-11-9-15-17(19-16,12-6-2)18(20,13-7-3)14-8-4/h5-9,15-16,19-20H,1-4,10-14H2/p+1/t16-,17-/m0/s1 |
| InChIKey | AGDLMXLWDBLZLG-IRXDYDNUSA-O |
| XLogP | 2.65 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|