C20H23N3O2S — CID 7567666
3-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione (PubChem CID 7567666) has the molecular formula C20H23N3O2S and a molecular weight of 369.49 g/mol. Its IUPAC name is 3-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione.
| Compound Name | 3-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
|---|---|
| PubChem CID | 7567666 |
| Molecular Formula | C20H23N3O2S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 3-[[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl]-1,3-diazaspiro[4.6]undecane-2,4-dione |
| SMILES | Cc1ccc(-c2nc(CN3C(=O)NC4(CCCCCC4)C3=O)cs2)cc1 |
| InChI | InChI=1S/C20H23N3O2S/c1-14-6-8-15(9-7-14)17-21-16(13-26-17)12-23-18(24)20(22-19(23)25)10-4-2-3-5-11-20/h6-9,13H,2-5,10-12H2,1H3,(H,22,25) |
| InChIKey | JBENSTBGJZZQOY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|