C21H13F5O3 — CID 7567839
[(1R,6R)-1-(9H-fluoren-9-ylmethyl)-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl] hydrogen carbonate (PubChem CID 7567839) has the molecular formula C21H13F5O3 and a molecular weight of 408.32 g/mol. Its IUPAC name is [(1R,6R)-1-(9H-fluoren-9-ylmethyl)-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl] hydrogen carbonate.
| Compound Name | [(1R,6R)-1-(9H-fluoren-9-ylmethyl)-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 7567839 |
| Molecular Formula | C21H13F5O3 |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | [(1R,6R)-1-(9H-fluoren-9-ylmethyl)-2,3,4,5,6-pentafluorocyclohexa-2,4-dien-1-yl] hydrogen carbonate |
| SMILES | O=C(O)O[C@@]1(CC2c3ccccc3-c3ccccc32)C(F)=C(F)C(F)=C(F)[C@@H]1F |
| InChI | InChI=1S/C21H13F5O3/c22-15-16(23)18(25)21(29-20(27)28,19(26)17(15)24)9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14,18H,9H2,(H,27,28)/t18-,21+/m0/s1 |
| InChIKey | YQCQZAIPKWXXJX-GHTZIAJQSA-N |
| XLogP | 6.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |