C22H26Cl2N4O2 — CID 75683424
3-(4-chloro-2-hydroxyphenyl)-4-(4-chlorophenyl)-5-[3-(dimethylamino)propyl]-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one (PubChem CID 75683424) has the molecular formula C22H26Cl2N4O2 and a molecular weight of 449.38 g/mol. Its IUPAC name is 3-(4-chloro-2-hydroxyphenyl)-4-(4-chlorophenyl)-5-[3-(dimethylamino)propyl]-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one.
| Compound Name | 3-(4-chloro-2-hydroxyphenyl)-4-(4-chlorophenyl)-5-[3-(dimethylamino)propyl]-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one |
|---|---|
| PubChem CID | 75683424 |
| Molecular Formula | C22H26Cl2N4O2 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 3-(4-chloro-2-hydroxyphenyl)-4-(4-chlorophenyl)-5-[3-(dimethylamino)propyl]-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one |
| SMILES | CN(C)CCCN1C(=O)C2NNC(c3ccc(Cl)cc3O)C2C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26Cl2N4O2/c1-27(2)10-3-11-28-21(13-4-6-14(23)7-5-13)18-19(25-26-20(18)22(28)30)16-9-8-15(24)12-17(16)29/h4-9,12,18-21,25-26,29H,3,10-11H2,1-2H3 |
| InChIKey | NUYCCRHHRFXDJA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|