C21H23N3O6 — CID 7569068
[2-[[2-(2,5-dimethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-methyl-2-nitrobenzoate (PubChem CID 7569068) has the molecular formula C21H23N3O6 and a molecular weight of 413.43 g/mol. Its IUPAC name is [2-[[2-(2,5-dimethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-methyl-2-nitrobenzoate.
| Compound Name | [2-[[2-(2,5-dimethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-methyl-2-nitrobenzoate |
|---|---|
| PubChem CID | 7569068 |
| Molecular Formula | C21H23N3O6 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [2-[[2-(2,5-dimethylanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-methyl-2-nitrobenzoate |
| SMILES | Cc1ccc(C)c(NC(=O)CN(C)C(=O)COC(=O)c2cccc(C)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N3O6/c1-13-8-9-14(2)17(10-13)22-18(25)11-23(4)19(26)12-30-21(27)16-7-5-6-15(3)20(16)24(28)29/h5-10H,11-12H2,1-4H3,(H,22,25) |
| InChIKey | CXKMJTRSPKWSQH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|