About (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one
(2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 7570157) has the molecular formula C11H17N5OS
and a molecular weight of 267.36 g/mol. Its IUPAC name is (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one |
| PubChem CID | 7570157 |
| Molecular Formula | C11H17N5OS |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | C[C@H](Sc1nc(N)cc(N)n1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C11H17N5OS/c1-7(10(17)16-4-2-3-5-16)18-11-14-8(12)6-9(13)15-11/h6-7H,2-5H2,1H3,(H4,12,13,14,15)/t7-/m0/s1 |
| InChIKey | MPJQEQCNEIZJBE-ZETCQYMHSA-N |
| XLogP | 0.74 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one?
The IUPAC name of (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one (CID 7570157) is (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one.
What is the SMILES notation for (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one?
The canonical SMILES for (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one is C[C@H](Sc1nc(N)cc(N)n1)C(=O)N1CCCC1.
What is the InChIKey of (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one?
The InChIKey is MPJQEQCNEIZJBE-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H17N5OS/c1-7(10(17)16-4-2-3-5-16)18-11-14-8(12)6-9(13)15-11/h6-7H,2-5H2,1H3,(H4,12,13,14,15)/t7-/m0/s1.
What are the key properties of (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one?
(2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one has a molecular weight of 267.36 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(4,6-diaminopyrimidin-2-yl)sulfanyl-1-pyrrolidin-1-ylpropan-1-one is sourced from PubChem (CID 7570157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).