C18H13NO3S2 — CID 7573626
N-benzyl-3-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene-9-sulfonamide (PubChem CID 7573626) has the molecular formula C18H13NO3S2 and a molecular weight of 355.44 g/mol. Its IUPAC name is N-benzyl-3-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene-9-sulfonamide.
| Compound Name | N-benzyl-3-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene-9-sulfonamide |
|---|---|
| PubChem CID | 7573626 |
| Molecular Formula | C18H13NO3S2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | N-benzyl-3-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaene-9-sulfonamide |
| SMILES | O=C1Sc2ccc(S(=O)(=O)NCc3ccccc3)c3cccc1c23 |
| InChI | InChI=1S/C18H13NO3S2/c20-18-14-8-4-7-13-16(10-9-15(23-18)17(13)14)24(21,22)19-11-12-5-2-1-3-6-12/h1-10,19H,11H2 |
| InChIKey | YBKFNXAQAWTGLI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|