C19H18BrNO4 — CID 7574114
5-bromo-1-[(4-ethoxy-3-methoxyphenyl)methyl]-7-methylindole-2,3-dione (PubChem CID 7574114) has the molecular formula C19H18BrNO4 and a molecular weight of 404.26 g/mol. Its IUPAC name is 5-bromo-1-[(4-ethoxy-3-methoxyphenyl)methyl]-7-methylindole-2,3-dione.
| Compound Name | 5-bromo-1-[(4-ethoxy-3-methoxyphenyl)methyl]-7-methylindole-2,3-dione |
|---|---|
| PubChem CID | 7574114 |
| Molecular Formula | C19H18BrNO4 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 5-bromo-1-[(4-ethoxy-3-methoxyphenyl)methyl]-7-methylindole-2,3-dione |
| SMILES | CCOc1ccc(CN2C(=O)C(=O)c3cc(Br)cc(C)c32)cc1OC |
| InChI | InChI=1S/C19H18BrNO4/c1-4-25-15-6-5-12(8-16(15)24-3)10-21-17-11(2)7-13(20)9-14(17)18(22)19(21)23/h5-9H,4,10H2,1-3H3 |
| InChIKey | WFGNLIZWDUZTPC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|