C10H11N5O — CID 757415
2-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 757415) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 757415 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 2-N-(4-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Nc2ncnc(N)n2)cc1 |
| InChI | InChI=1S/C10H11N5O/c1-16-8-4-2-7(3-5-8)14-10-13-6-12-9(11)15-10/h2-6H,1H3,(H3,11,12,13,14,15) |
| InChIKey | NLFPJEGIIOQLNS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |