C20H13N2O3S2- — CID 7575504
4-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanylmethyl]benzoate (PubChem CID 7575504) has the molecular formula C20H13N2O3S2- and a molecular weight of 393.47 g/mol. Its IUPAC name is 4-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanylmethyl]benzoate.
| Compound Name | 4-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 7575504 |
| Molecular Formula | C20H13N2O3S2- |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | 4-[(4-oxo-5-phenyl-3H-thieno[2,3-d]pyrimidin-2-yl)sulfanylmethyl]benzoate |
| SMILES | O=C([O-])c1ccc(CSc2nc3scc(-c4ccccc4)c3c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C20H14N2O3S2/c23-17-16-15(13-4-2-1-3-5-13)11-26-18(16)22-20(21-17)27-10-12-6-8-14(9-7-12)19(24)25/h1-9,11H,10H2,(H,24,25)(H,21,22,23)/p-1 |
| InChIKey | HOGNVWVDHNSZAO-UHFFFAOYSA-M |
| XLogP | 3.31 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |