About N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine
N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 757578) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine |
| PubChem CID | 757578 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(C)CC1CCCCC1 |
| InChI | InChI=1S/C12H26N2/c1-13(2)9-10-14(3)11-12-7-5-4-6-8-12/h12H,4-11H2,1-3H3 |
| InChIKey | DEDCTVPEOSSSRL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine?
The IUPAC name of N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine (CID 757578) is N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine.
What is the SMILES notation for N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine?
The canonical SMILES for N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine is CN(C)CCN(C)CC1CCCCC1.
What is the InChIKey of N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine?
The InChIKey is DEDCTVPEOSSSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-13(2)9-10-14(3)11-12-7-5-4-6-8-12/h12H,4-11H2,1-3H3.
What are the key properties of N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine?
N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine has a molecular weight of 198.35 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(cyclohexylmethyl)-N,N,N'-trimethylethane-1,2-diamine is sourced from PubChem (CID 757578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).