About [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone
[(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone (PubChem CID 7576694) has the molecular formula C11H17N3OS
and a molecular weight of 239.34 g/mol. Its IUPAC name is [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone.
Molecular Properties
| Compound Name | [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
| PubChem CID | 7576694 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1C[C@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C11H17N3OS/c1-7-4-8(2)6-14(5-7)11(15)10-9(3)12-13-16-10/h7-8H,4-6H2,1-3H3/t7-,8+ |
| InChIKey | ZRRMYJZMAYMQNZ-OCAPTIKFSA-N |
| XLogP | 1.96 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone?
The IUPAC name of [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone (CID 7576694) is [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone.
What is the SMILES notation for [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone?
The canonical SMILES for [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone is Cc1nnsc1C(=O)N1C[C@H](C)C[C@H](C)C1.
What is the InChIKey of [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone?
The InChIKey is ZRRMYJZMAYMQNZ-OCAPTIKFSA-N. The full InChI is InChI=1S/C11H17N3OS/c1-7-4-8(2)6-14(5-7)11(15)10-9(3)12-13-16-10/h7-8H,4-6H2,1-3H3/t7-,8+.
What are the key properties of [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone?
[(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone has a molecular weight of 239.34 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,5S)-3,5-dimethylpiperidin-1-yl]-(4-methylthiadiazol-5-yl)methanone is sourced from PubChem (CID 7576694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).