C17H20N4O2S — CID 75767911
2,4-dimethyl-3-oxo-N-(1-propan-2-ylpyrazol-4-yl)-1,4-benzothiazine-2-carboxamide (PubChem CID 75767911) has the molecular formula C17H20N4O2S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2,4-dimethyl-3-oxo-N-(1-propan-2-ylpyrazol-4-yl)-1,4-benzothiazine-2-carboxamide.
| Compound Name | 2,4-dimethyl-3-oxo-N-(1-propan-2-ylpyrazol-4-yl)-1,4-benzothiazine-2-carboxamide |
|---|---|
| PubChem CID | 75767911 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2,4-dimethyl-3-oxo-N-(1-propan-2-ylpyrazol-4-yl)-1,4-benzothiazine-2-carboxamide |
| SMILES | CC(C)n1cc(NC(=O)C2(C)Sc3ccccc3N(C)C2=O)cn1 |
| InChI | InChI=1S/C17H20N4O2S/c1-11(2)21-10-12(9-18-21)19-15(22)17(3)16(23)20(4)13-7-5-6-8-14(13)24-17/h5-11H,1-4H3,(H,19,22) |
| InChIKey | VEQILWIBOBFSMQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|